C12H9Cl2NO3 — CID 71331151
3-(2,2-dichloroacetyl)-1-methylquinoline-2,4-dione (PubChem CID 71331151) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is 3-(2,2-dichloroacetyl)-1-methylquinoline-2,4-dione.
| Compound Name | 3-(2,2-dichloroacetyl)-1-methylquinoline-2,4-dione |
|---|---|
| PubChem CID | 71331151 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-(2,2-dichloroacetyl)-1-methylquinoline-2,4-dione |
| SMILES | CN1C(=O)C(C(=O)C(Cl)Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H9Cl2NO3/c1-15-7-5-3-2-4-6(7)9(16)8(12(15)18)10(17)11(13)14/h2-5,8,11H,1H3 |
| InChIKey | COBZLDCGMCYAFO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|