C18H15NO2 — CID 117066362
3-phenyl-1-prop-2-enylquinoline-2,4-dione (PubChem CID 117066362) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-phenyl-1-prop-2-enylquinoline-2,4-dione.
| Compound Name | 3-phenyl-1-prop-2-enylquinoline-2,4-dione |
|---|---|
| PubChem CID | 117066362 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-phenyl-1-prop-2-enylquinoline-2,4-dione |
| SMILES | C=CCN1C(=O)C(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H15NO2/c1-2-12-19-15-11-7-6-10-14(15)17(20)16(18(19)21)13-8-4-3-5-9-13/h2-11,16H,1,12H2 |
| InChIKey | BIGJBQFOZAMKDI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|