C17H14F2N2O — CID 82157494
6,7-difluoro-3-phenyl-1-prop-2-enyl-3,4-dihydroquinoxalin-2-one (PubChem CID 82157494) has the molecular formula C17H14F2N2O and a molecular weight of 300.31 g/mol. Its IUPAC name is 6,7-difluoro-3-phenyl-1-prop-2-enyl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 6,7-difluoro-3-phenyl-1-prop-2-enyl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 82157494 |
| Molecular Formula | C17H14F2N2O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 6,7-difluoro-3-phenyl-1-prop-2-enyl-3,4-dihydroquinoxalin-2-one |
| SMILES | C=CCN1C(=O)C(c2ccccc2)Nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C17H14F2N2O/c1-2-8-21-15-10-13(19)12(18)9-14(15)20-16(17(21)22)11-6-4-3-5-7-11/h2-7,9-10,16,20H,1,8H2 |
| InChIKey | ITOZSCCTYWZQSP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|