C16H16N4O2S2 — CID 6996163
[(3R)-3-(1H-benzimidazol-2-yl)-3-cyano-2-oxopropyl] morpholine-4-carbodithioate (PubChem CID 6996163) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(3R)-3-(1H-benzimidazol-2-yl)-3-cyano-2-oxopropyl] morpholine-4-carbodithioate.
| Compound Name | [(3R)-3-(1H-benzimidazol-2-yl)-3-cyano-2-oxopropyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 6996163 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [(3R)-3-(1H-benzimidazol-2-yl)-3-cyano-2-oxopropyl] morpholine-4-carbodithioate |
| SMILES | N#C[C@@H](C(=O)CSC(=S)N1CCOCC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H16N4O2S2/c17-9-11(15-18-12-3-1-2-4-13(12)19-15)14(21)10-24-16(23)20-5-7-22-8-6-20/h1-4,11H,5-8,10H2,(H,18,19)/t11-/m0/s1 |
| InChIKey | WPFHIKFARCDNLG-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|