C26H24N6O4S — CID 6996572
2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide (PubChem CID 6996572) has the molecular formula C26H24N6O4S and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide.
| Compound Name | 2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide |
|---|---|
| PubChem CID | 6996572 |
| Molecular Formula | C26H24N6O4S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N'-[1-(3-nitrophenyl)ethenyl]acetohydrazide |
| SMILES | C=C(NNC(=O)CSc1nnc(-c2ccccc2)n1-c1ccc(OCC)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24N6O4S/c1-3-36-23-14-12-21(13-15-23)31-25(19-8-5-4-6-9-19)29-30-26(31)37-17-24(33)28-27-18(2)20-10-7-11-22(16-20)32(34)35/h4-16,27H,2-3,17H2,1H3,(H,28,33) |
| InChIKey | ZUXYFZHOPUZFFI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|