C15H13N4O5S- — CID 6997022
2-methoxy-4-nitro-6-[(Z)-[(2-pyridin-2-ylsulfanylacetyl)hydrazinylidene]methyl]phenolate (PubChem CID 6997022) has the molecular formula C15H13N4O5S- and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-methoxy-4-nitro-6-[(Z)-[(2-pyridin-2-ylsulfanylacetyl)hydrazinylidene]methyl]phenolate.
| Compound Name | 2-methoxy-4-nitro-6-[(Z)-[(2-pyridin-2-ylsulfanylacetyl)hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 6997022 |
| Molecular Formula | C15H13N4O5S- |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-methoxy-4-nitro-6-[(Z)-[(2-pyridin-2-ylsulfanylacetyl)hydrazinylidene]methyl]phenolate |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N\NC(=O)CSc2ccccn2)c1[O-] |
| InChI | InChI=1S/C15H14N4O5S/c1-24-12-7-11(19(22)23)6-10(15(12)21)8-17-18-13(20)9-25-14-4-2-3-5-16-14/h2-8,21H,9H2,1H3,(H,18,20)/p-1/b17-8- |
| InChIKey | ACJWIASIYBEPTR-IUXPMGMMSA-M |
| XLogP | 1.31 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|