C32H33N3O5S — CID 6998353
N-[(2R)-1-(N-[[2-hydroxy-2,2-bis(4-methylphenyl)acetyl]amino]anilino)-1-oxopropan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 6998353) has the molecular formula C32H33N3O5S and a molecular weight of 571.70 g/mol. Its IUPAC name is N-[(2R)-1-(N-[[2-hydroxy-2,2-bis(4-methylphenyl)acetyl]amino]anilino)-1-oxopropan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-1-(N-[[2-hydroxy-2,2-bis(4-methylphenyl)acetyl]amino]anilino)-1-oxopropan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6998353 |
| Molecular Formula | C32H33N3O5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | N-[(2R)-1-(N-[[2-hydroxy-2,2-bis(4-methylphenyl)acetyl]amino]anilino)-1-oxopropan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(O)(C(=O)NN(C(=O)[C@@H](C)NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H33N3O5S/c1-22-10-16-26(17-11-22)32(38,27-18-12-23(2)13-19-27)31(37)33-35(28-8-6-5-7-9-28)30(36)25(4)34-41(39,40)29-20-14-24(3)15-21-29/h5-21,25,34,38H,1-4H3,(H,33,37)/t25-/m1/s1 |
| InChIKey | IBBBBAKTMPCGOI-RUZDIDTESA-N |
| XLogP | 4.28 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|