C14H20BrN3O3 — CID 6999204
(3S)-4-(4-bromoanilino)-3-[2-(ethylamino)ethylamino]-4-oxobutanoic acid (PubChem CID 6999204) has the molecular formula C14H20BrN3O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is (3S)-4-(4-bromoanilino)-3-[2-(ethylamino)ethylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-(4-bromoanilino)-3-[2-(ethylamino)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6999204 |
| Molecular Formula | C14H20BrN3O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (3S)-4-(4-bromoanilino)-3-[2-(ethylamino)ethylamino]-4-oxobutanoic acid |
| SMILES | CCNCCN[C@@H](CC(=O)O)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrN3O3/c1-2-16-7-8-17-12(9-13(19)20)14(21)18-11-5-3-10(15)4-6-11/h3-6,12,16-17H,2,7-9H2,1H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | ANRZGSZTRFXLKF-LBPRGKRZSA-N |
| XLogP | 1.43 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|