C10H9F3N2O — CID 70023407
6-amino-4-(trifluoromethyl)-7,8-dihydro-1H-quinolin-2-one (PubChem CID 70023407) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 6-amino-4-(trifluoromethyl)-7,8-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-4-(trifluoromethyl)-7,8-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70023407 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 6-amino-4-(trifluoromethyl)-7,8-dihydro-1H-quinolin-2-one |
| SMILES | NC1=Cc2c(C(F)(F)F)cc(=O)[nH]c2CC1 |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)7-4-9(16)15-8-2-1-5(14)3-6(7)8/h3-4H,1-2,14H2,(H,15,16) |
| InChIKey | RRRBYYVRSVUQNP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |