C22H22FN3O3 — CID 70026598
6-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylic acid (PubChem CID 70026598) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 6-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylic acid.
| Compound Name | 6-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 70026598 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 6-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(c4ccccc42)CCN(C(=O)O)CC3)c(F)c1 |
| InChI | InChI=1S/C22H22FN3O3/c1-14-6-7-18(17(23)12-14)24-21(27)13-26-19-5-3-2-4-15(19)16-8-10-25(22(28)29)11-9-20(16)26/h2-7,12H,8-11,13H2,1H3,(H,24,27)(H,28,29) |
| InChIKey | ZKROIYGQJAMEIO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|