C33H39N5O5Si — CID 70029291
methyl (Z)-3-(2H-benzotriazol-5-yl)-2-[[4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylcarbamoyl]-2,6-dimethylbenzoyl]amino]prop-2-enoate (PubChem CID 70029291) has the molecular formula C33H39N5O5Si and a molecular weight of 613.79 g/mol. Its IUPAC name is methyl (Z)-3-(2H-benzotriazol-5-yl)-2-[[4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylcarbamoyl]-2,6-dimethylbenzoyl]amino]prop-2-enoate.
| Compound Name | methyl (Z)-3-(2H-benzotriazol-5-yl)-2-[[4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylcarbamoyl]-2,6-dimethylbenzoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 70029291 |
| Molecular Formula | C33H39N5O5Si |
| Molecular Weight | 613.79 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | methyl (Z)-3-(2H-benzotriazol-5-yl)-2-[[4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]methylcarbamoyl]-2,6-dimethylbenzoyl]amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc2n[nH]nc2c1)NC(=O)c1c(C)cc(C(=O)NCc2cccc(O[Si](C)(C)C(C)(C)C)c2)cc1C |
| InChI | InChI=1S/C33H39N5O5Si/c1-20-14-24(30(39)34-19-23-10-9-11-25(16-23)43-44(7,8)33(3,4)5)15-21(2)29(20)31(40)35-28(32(41)42-6)18-22-12-13-26-27(17-22)37-38-36-26/h9-18H,19H2,1-8H3,(H,34,39)(H,35,40)(H,36,37,38)/b28-18- |
| InChIKey | NFXQBRRZCBYZRY-VEILYXNESA-N |
| XLogP | 5.83 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.79 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|