C40H32N2O6S2 — CID 70031259
2-[benzyl-[1,1-bis(1-benzothiophen-3-yloxy)ethyl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone (PubChem CID 70031259) has the molecular formula C40H32N2O6S2 and a molecular weight of 700.84 g/mol. Its IUPAC name is 2-[benzyl-[1,1-bis(1-benzothiophen-3-yloxy)ethyl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone.
| Compound Name | 2-[benzyl-[1,1-bis(1-benzothiophen-3-yloxy)ethyl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 70031259 |
| Molecular Formula | C40H32N2O6S2 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | 2-[benzyl-[1,1-bis(1-benzothiophen-3-yloxy)ethyl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
| SMILES | CC(Oc1csc2ccccc12)(Oc1csc2ccccc12)N(CC(=O)c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1)Cc1ccccc1 |
| InChI | InChI=1S/C40H32N2O6S2/c1-40(47-36-26-49-38-18-10-8-16-31(36)38,48-37-27-50-39-19-11-9-17-32(37)39)41(23-28-12-4-2-5-13-28)24-34(43)30-20-21-35(33(22-30)42(44)45)46-25-29-14-6-3-7-15-29/h2-22,26-27H,23-25H2,1H3 |
| InChIKey | HEMWLGXQJZDMNS-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|