C22H17N3O2 — CID 70037860
[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]methanol (PubChem CID 70037860) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is [2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]methanol.
| Compound Name | [2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]methanol |
|---|---|
| PubChem CID | 70037860 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]methanol |
| SMILES | OCOc1ccccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H17N3O2/c26-15-27-19-14-8-7-13-18(19)22-24-20(16-9-3-1-4-10-16)23-21(25-22)17-11-5-2-6-12-17/h1-14,26H,15H2 |
| InChIKey | OWVJZLCQEYUWHW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|