C19H16N4O3 — CID 871154
[2-(4-acetamido-6-phenyl-1,3,5-triazin-2-yl)phenyl] acetate (PubChem CID 871154) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is [2-(4-acetamido-6-phenyl-1,3,5-triazin-2-yl)phenyl] acetate.
| Compound Name | [2-(4-acetamido-6-phenyl-1,3,5-triazin-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 871154 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [2-(4-acetamido-6-phenyl-1,3,5-triazin-2-yl)phenyl] acetate |
| SMILES | CC(=O)Nc1nc(-c2ccccc2)nc(-c2ccccc2OC(C)=O)n1 |
| InChI | InChI=1S/C19H16N4O3/c1-12(24)20-19-22-17(14-8-4-3-5-9-14)21-18(23-19)15-10-6-7-11-16(15)26-13(2)25/h3-11H,1-2H3,(H,20,21,22,23,24) |
| InChIKey | FYGLIUBZOQDEEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|