C9H15N2OS+ — CID 7003843
4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholin-4-ium (PubChem CID 7003843) has the molecular formula C9H15N2OS+ and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholin-4-ium.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7003843 |
| Molecular Formula | C9H15N2OS+ |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]morpholin-4-ium |
| SMILES | Cc1nc(C[NH+]2CCOCC2)cs1 |
| InChI | InChI=1S/C9H14N2OS/c1-8-10-9(7-13-8)6-11-2-4-12-5-3-11/h7H,2-6H2,1H3/p+1 |
| InChIKey | CDOSGNCKLTWOGE-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |