C34H52N7O7P — CID 70040156
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[[(2S)-1-[(2S)-2-(dibenzylphosphorylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 70040156) has the molecular formula C34H52N7O7P and a molecular weight of 701.81 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[[(2S)-1-[(2S)-2-(dibenzylphosphorylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[[(2S)-1-[(2S)-2-(dibenzylphosphorylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70040156 |
| Molecular Formula | C34H52N7O7P |
| Molecular Weight | 701.81 g/mol |
| Exact Mass | 701.37 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-[[(2S)-1-[(2S)-2-(dibenzylphosphorylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NP(=O)(Cc1ccccc1)Cc1ccccc1)C(=O)O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C28H38N3O5P.C6H14N4O2/c1-20(2)17-24(28(34)35)29-26(32)25-15-10-16-31(25)27(33)21(3)30-37(36,18-22-11-6-4-7-12-22)19-23-13-8-5-9-14-23;7-4(5(11)12)2-1-3-10-6(8)9/h4-9,11-14,20-21,24-25H,10,15-19H2,1-3H3,(H,29,32)(H,30,36)(H,34,35);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t21-,24-,25-;4-/m00/s1 |
| InChIKey | KPBNJVTZQOYADD-RUJMHOJTSA-N |
| XLogP | 2.70 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|