C17H19F3O7 — CID 70041682
2-[2-[5-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl]ethoxy]acetic acid (PubChem CID 70041682) has the molecular formula C17H19F3O7 and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 70041682 |
| Molecular Formula | C17H19F3O7 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[2-[5-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl]ethoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)c1ccc(OC(=O)C(F)(F)F)c(CCOCC(=O)O)c1 |
| InChI | InChI=1S/C17H19F3O7/c1-16(2,3)27-14(23)11-4-5-12(26-15(24)17(18,19)20)10(8-11)6-7-25-9-13(21)22/h4-5,8H,6-7,9H2,1-3H3,(H,21,22) |
| InChIKey | RIYGNZPRBGPOHK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|