C28H28N2O8 — CID 70042245
4-[4-[2-amino-3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]-2-methoxy-5-nitrophenoxy]butanoic acid (PubChem CID 70042245) has the molecular formula C28H28N2O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is 4-[4-[2-amino-3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]-2-methoxy-5-nitrophenoxy]butanoic acid.
| Compound Name | 4-[4-[2-amino-3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
|---|---|
| PubChem CID | 70042245 |
| Molecular Formula | C28H28N2O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 4-[4-[2-amino-3-(9H-fluoren-9-ylmethoxy)-3-oxopropyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
| SMILES | COc1cc(CC(N)C(=O)OCC2c3ccccc3-c3ccccc32)c([N+](=O)[O-])cc1OCCCC(=O)O |
| InChI | InChI=1S/C28H28N2O8/c1-36-25-14-17(24(30(34)35)15-26(25)37-12-6-11-27(31)32)13-23(29)28(33)38-16-22-20-9-4-2-7-18(20)19-8-3-5-10-21(19)22/h2-5,7-10,14-15,22-23H,6,11-13,16,29H2,1H3,(H,31,32) |
| InChIKey | KKBXALWWWJNPMC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|