C30H29N2O9- — CID 146031108
N-[(2R)-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-1-oxo-1-prop-2-enoxypropan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate (PubChem CID 146031108) has the molecular formula C30H29N2O9- and a molecular weight of 561.57 g/mol. Its IUPAC name is N-[(2R)-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-1-oxo-1-prop-2-enoxypropan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate.
| Compound Name | N-[(2R)-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-1-oxo-1-prop-2-enoxypropan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate |
|---|---|
| PubChem CID | 146031108 |
| Molecular Formula | C30H29N2O9- |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-[(2R)-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]-1-oxo-1-prop-2-enoxypropan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate |
| SMILES | C=CCOC(=O)[C@@H](COCc1cc(OC)c(OC)cc1[N+](=O)[O-])/N=C(\[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H30N2O9/c1-4-13-40-29(33)25(18-39-16-19-14-27(37-2)28(38-3)15-26(19)32(35)36)31-30(34)41-17-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h4-12,14-15,24-25H,1,13,16-18H2,2-3H3,(H,31,34)/p-1/t25-/m1/s1 |
| InChIKey | RFPFIZBKXMAOQH-RUZDIDTESA-M |
| XLogP | 3.77 |
| TPSA | 141.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|