C20H29N3O5 — CID 70047874
3,5-dimethyl-1H-pyrazole;2-hydroxy-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 70047874) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrazole;2-hydroxy-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 3,5-dimethyl-1H-pyrazole;2-hydroxy-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 70047874 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3,5-dimethyl-1H-pyrazole;2-hydroxy-5-methyl-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)CCC(O)(NC(=O)OCc1ccccc1)C(=O)O.Cc1cc(C)[nH]n1 |
| InChI | InChI=1S/C15H21NO5.C5H8N2/c1-11(2)8-9-15(20,13(17)18)16-14(19)21-10-12-6-4-3-5-7-12;1-4-3-5(2)7-6-4/h3-7,11,20H,8-10H2,1-2H3,(H,16,19)(H,17,18);3H,1-2H3,(H,6,7) |
| InChIKey | ZOAARXGQTNTBIU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|