C38H40N2O5 — CID 70049020
(2R,4R)-4-hydroxy-N,N-bis[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-methyl-2,6-diphenylheptanediamide (PubChem CID 70049020) has the molecular formula C38H40N2O5 and a molecular weight of 604.75 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-N,N-bis[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-methyl-2,6-diphenylheptanediamide.
| Compound Name | (2R,4R)-4-hydroxy-N,N-bis[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-methyl-2,6-diphenylheptanediamide |
|---|---|
| PubChem CID | 70049020 |
| Molecular Formula | C38H40N2O5 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | (2R,4R)-4-hydroxy-N,N-bis[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-methyl-2,6-diphenylheptanediamide |
| SMILES | C[C@](C[C@H](O)CC(C(N)=O)c1ccccc1)(C(=O)N([C@H]1c2ccccc2C[C@H]1O)[C@H]1c2ccccc2C[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C38H40N2O5/c1-38(27-16-6-3-7-17-27,23-28(41)22-31(36(39)44)24-12-4-2-5-13-24)37(45)40(34-29-18-10-8-14-25(29)20-32(34)42)35-30-19-11-9-15-26(30)21-33(35)43/h2-19,28,31-35,41-43H,20-23H2,1H3,(H2,39,44)/t28-,31?,32-,33-,34+,35+,38-/m1/s1 |
| InChIKey | YILSRYUZCQKJIO-JKLVKOPHSA-N |
| XLogP | 4.50 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |