C25H43NO4 — CID 70049157
(8R,9R,10S,13S,14R)-17-(3-aminopropoxy)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol (PubChem CID 70049157) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is (8R,9R,10S,13S,14R)-17-(3-aminopropoxy)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol.
| Compound Name | (8R,9R,10S,13S,14R)-17-(3-aminopropoxy)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 70049157 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | (8R,9R,10S,13S,14R)-17-(3-aminopropoxy)-17-(1,3-dioxolan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(OCCCN)(C3OCCO3)CC[C@@]12O |
| InChI | InChI=1S/C25H43NO4/c1-22-10-4-3-6-18(22)7-8-20-19(22)9-11-23(2)24(20,27)12-13-25(23,30-15-5-14-26)21-28-16-17-29-21/h18-21,27H,3-17,26H2,1-2H3/t18?,19-,20-,22+,23+,24-,25?/m1/s1 |
| InChIKey | XWSKAQSDZSUIRV-PHMDSMIHSA-N |
| XLogP | 4.01 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|