C25H42O5 — CID 22855527
(3R,5R,8R,9S,10S,13S,14S)-2-(1,3-dioxolan-2-yl)-3-(3-hydroxypropoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 22855527) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S)-2-(1,3-dioxolan-2-yl)-3-(3-hydroxypropoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S)-2-(1,3-dioxolan-2-yl)-3-(3-hydroxypropoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 22855527 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S)-2-(1,3-dioxolan-2-yl)-3-(3-hydroxypropoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | C[C@]12CC(C3OCCO3)[C@H](OCCCO)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)CCC[C@]12O |
| InChI | InChI=1S/C25H42O5/c1-23-8-3-9-25(23,27)20-6-5-17-15-21(28-12-4-11-26)18(22-29-13-14-30-22)16-24(17,2)19(20)7-10-23/h17-22,26-27H,3-16H2,1-2H3/t17-,18?,19+,20-,21-,23+,24+,25+/m1/s1 |
| InChIKey | LNPCLDAEOYVGHC-NCVPQXPHSA-N |
| XLogP | 3.90 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|