C25H40O4 — CID 67647498
(3S,5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-10,13-dimethyl-17-prop-1-enyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 67647498) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-10,13-dimethyl-17-prop-1-enyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (3S,5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-10,13-dimethyl-17-prop-1-enyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 67647498 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (3S,5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-10,13-dimethyl-17-prop-1-enyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | CC=C[C@H]1CC[C@]2(O)[C@@H]3CC[C@@H]4C[C@H](O)C(C5OCCO5)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H40O4/c1-4-5-16-8-11-25(27)20-7-6-17-14-21(26)18(22-28-12-13-29-22)15-23(17,2)19(20)9-10-24(16,25)3/h4-5,16-22,26-27H,6-15H2,1-3H3/t16-,17+,18?,19-,20+,21-,23-,24+,25-/m0/s1 |
| InChIKey | DZCRASSVZXOWEQ-HULLSVCYSA-N |
| XLogP | 4.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|