C25H38O4 — CID 67648403
(5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-14-hydroxy-10,13-dimethyl-17-prop-1-enyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 67648403) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-14-hydroxy-10,13-dimethyl-17-prop-1-enyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-14-hydroxy-10,13-dimethyl-17-prop-1-enyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67648403 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (5R,8R,9S,10S,13R,14S,17R)-2-(1,3-dioxolan-2-yl)-14-hydroxy-10,13-dimethyl-17-prop-1-enyl-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC=C[C@H]1CC[C@]2(O)[C@@H]3CC[C@@H]4CC(=O)C(C5OCCO5)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38O4/c1-4-5-16-8-11-25(27)20-7-6-17-14-21(26)18(22-28-12-13-29-22)15-23(17,2)19(20)9-10-24(16,25)3/h4-5,16-20,22,27H,6-15H2,1-3H3/t16-,17+,18?,19-,20+,23-,24+,25-/m0/s1 |
| InChIKey | XIWOXDJVWOUEGJ-DKYILDAISA-N |
| XLogP | 4.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|