C20H23NO7 — CID 70049646
2-[2-hydroxy-4-[(1R)-1-hydroxy-2-[3-(4-methoxyphenyl)propylamino]ethyl]phenoxy]-2-oxoacetic acid (PubChem CID 70049646) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-[2-hydroxy-4-[(1R)-1-hydroxy-2-[3-(4-methoxyphenyl)propylamino]ethyl]phenoxy]-2-oxoacetic acid.
| Compound Name | 2-[2-hydroxy-4-[(1R)-1-hydroxy-2-[3-(4-methoxyphenyl)propylamino]ethyl]phenoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 70049646 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[2-hydroxy-4-[(1R)-1-hydroxy-2-[3-(4-methoxyphenyl)propylamino]ethyl]phenoxy]-2-oxoacetic acid |
| SMILES | COc1ccc(CCCNC[C@H](O)c2ccc(OC(=O)C(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C20H23NO7/c1-27-15-7-4-13(5-8-15)3-2-10-21-12-17(23)14-6-9-18(16(22)11-14)28-20(26)19(24)25/h4-9,11,17,21-23H,2-3,10,12H2,1H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | TVJQNVXBFCJHDN-KRWDZBQOSA-N |
| XLogP | 1.65 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|