C25H29F2NO2 — CID 70055338
4-[(4aS,8aS)-6-(4-fluorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 70055338) has the molecular formula C25H29F2NO2 and a molecular weight of 413.51 g/mol. Its IUPAC name is 4-[(4aS,8aS)-6-(4-fluorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[(4aS,8aS)-6-(4-fluorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70055338 |
| Molecular Formula | C25H29F2NO2 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 4-[(4aS,8aS)-6-(4-fluorophenyl)-6-hydroxy-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-2-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCN1CC[C@H]2CC(O)(c3ccc(F)cc3)CC[C@@H]2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29F2NO2/c26-22-7-3-18(4-8-22)24(29)2-1-14-28-15-12-19-16-25(30,13-11-20(19)17-28)21-5-9-23(27)10-6-21/h3-10,19-20,30H,1-2,11-17H2/t19-,20+,25?/m0/s1 |
| InChIKey | ZPSAMVBETLLNTC-KYWQPSMRSA-N |
| XLogP | 4.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |