C19H23NO2 — CID 70060548
4-[2-[(2S,5S)-5-[hydroxy(phenyl)methyl]pyrrolidin-2-yl]ethyl]phenol (PubChem CID 70060548) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-[2-[(2S,5S)-5-[hydroxy(phenyl)methyl]pyrrolidin-2-yl]ethyl]phenol.
| Compound Name | 4-[2-[(2S,5S)-5-[hydroxy(phenyl)methyl]pyrrolidin-2-yl]ethyl]phenol |
|---|---|
| PubChem CID | 70060548 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-[2-[(2S,5S)-5-[hydroxy(phenyl)methyl]pyrrolidin-2-yl]ethyl]phenol |
| SMILES | Oc1ccc(CC[C@H]2CC[C@@H](C(O)c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C19H23NO2/c21-17-11-7-14(8-12-17)6-9-16-10-13-18(20-16)19(22)15-4-2-1-3-5-15/h1-5,7-8,11-12,16,18-22H,6,9-10,13H2/t16-,18-,19?/m0/s1 |
| InChIKey | FLWWKBVIUMBHIM-SPIBDARASA-N |
| XLogP | 3.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |