C18H22N3O5P — CID 70061374
[[(2S)-1-[(2-aminoacetyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-methylamino]phosphonic acid (PubChem CID 70061374) has the molecular formula C18H22N3O5P and a molecular weight of 391.36 g/mol. Its IUPAC name is [[(2S)-1-[(2-aminoacetyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-methylamino]phosphonic acid.
| Compound Name | [[(2S)-1-[(2-aminoacetyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-methylamino]phosphonic acid |
|---|---|
| PubChem CID | 70061374 |
| Molecular Formula | C18H22N3O5P |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [[(2S)-1-[(2-aminoacetyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-methylamino]phosphonic acid |
| SMILES | CN([C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)NC(=O)CN)P(=O)(O)O |
| InChI | InChI=1S/C18H22N3O5P/c1-21(27(24,25)26)16(18(23)20-17(22)12-19)11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,16H,11-12,19H2,1H3,(H,20,22,23)(H2,24,25,26)/t16-/m0/s1 |
| InChIKey | RYEJKCNLOLFZRT-INIZCTEOSA-N |
| XLogP | 0.89 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|