C24H31ClN4O2 — CID 70062641
5-(3-chlorophenyl)-1-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]imidazolidin-2-one (PubChem CID 70062641) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-1-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]imidazolidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-1-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 70062641 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 5-(3-chlorophenyl)-1-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butyl]imidazolidin-2-one |
| SMILES | COc1cccc(N2CCN(CCCCN3C(=O)NCC3c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C24H31ClN4O2/c1-31-22-9-5-8-21(17-22)28-14-12-27(13-15-28)10-2-3-11-29-23(18-26-24(29)30)19-6-4-7-20(25)16-19/h4-9,16-17,23H,2-3,10-15,18H2,1H3,(H,26,30) |
| InChIKey | SEGLPOSZDGDZCX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|