C21H35N2+ — CID 70063141
2-ethyl-2-(5-piperidin-1-ylpentyl)-5,6-dihydro-3H-isoquinolin-2-ium (PubChem CID 70063141) has the molecular formula C21H35N2+ and a molecular weight of 315.53 g/mol. Its IUPAC name is 2-ethyl-2-(5-piperidin-1-ylpentyl)-5,6-dihydro-3H-isoquinolin-2-ium.
| Compound Name | 2-ethyl-2-(5-piperidin-1-ylpentyl)-5,6-dihydro-3H-isoquinolin-2-ium |
|---|---|
| PubChem CID | 70063141 |
| Molecular Formula | C21H35N2+ |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | 2-ethyl-2-(5-piperidin-1-ylpentyl)-5,6-dihydro-3H-isoquinolin-2-ium |
| SMILES | CC[N+]1(CCCCCN2CCCCC2)C=C2C=CCCC2=CC1 |
| InChI | InChI=1S/C21H35N2/c1-2-23(18-13-20-11-5-6-12-21(20)19-23)17-10-4-9-16-22-14-7-3-8-15-22/h6,12-13,19H,2-5,7-11,14-18H2,1H3/q+1 |
| InChIKey | RUGTUOYNHXFGET-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|