C17H17NO4 — CID 70067324
2-[6-[4-methoxy-3-[(E)-prop-1-enyl]phenyl]-2-oxo-1H-pyridin-3-yl]acetic acid (PubChem CID 70067324) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[6-[4-methoxy-3-[(E)-prop-1-enyl]phenyl]-2-oxo-1H-pyridin-3-yl]acetic acid.
| Compound Name | 2-[6-[4-methoxy-3-[(E)-prop-1-enyl]phenyl]-2-oxo-1H-pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70067324 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[6-[4-methoxy-3-[(E)-prop-1-enyl]phenyl]-2-oxo-1H-pyridin-3-yl]acetic acid |
| SMILES | C/C=C/c1cc(-c2ccc(CC(=O)O)c(=O)[nH]2)ccc1OC |
| InChI | InChI=1S/C17H17NO4/c1-3-4-12-9-11(6-8-15(12)22-2)14-7-5-13(10-16(19)20)17(21)18-14/h3-9H,10H2,1-2H3,(H,18,21)(H,19,20)/b4-3+ |
| InChIKey | LQKMRHVAQKQGDM-ONEGZZNKSA-N |
| XLogP | 2.71 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |