C13H7ClN2O4 — CID 70069519
7-(4-chloro-3-nitrophenyl)-7H-furo[3,4-b]pyridin-5-one (PubChem CID 70069519) has the molecular formula C13H7ClN2O4 and a molecular weight of 290.66 g/mol. Its IUPAC name is 7-(4-chloro-3-nitrophenyl)-7H-furo[3,4-b]pyridin-5-one.
| Compound Name | 7-(4-chloro-3-nitrophenyl)-7H-furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 70069519 |
| Molecular Formula | C13H7ClN2O4 |
| Molecular Weight | 290.66 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 7-(4-chloro-3-nitrophenyl)-7H-furo[3,4-b]pyridin-5-one |
| SMILES | O=C1OC(c2ccc(Cl)c([N+](=O)[O-])c2)c2ncccc21 |
| InChI | InChI=1S/C13H7ClN2O4/c14-9-4-3-7(6-10(9)16(18)19)12-11-8(13(17)20-12)2-1-5-15-11/h1-6,12H |
| InChIKey | RXSFXZCZWBGSKP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|