C23H28N2O4 — CID 70071439
ethyl 2-methylidene-4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-4-phenylbutanoate (PubChem CID 70071439) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 2-methylidene-4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-4-phenylbutanoate.
| Compound Name | ethyl 2-methylidene-4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 70071439 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl 2-methylidene-4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]-4-phenylbutanoate |
| SMILES | C=C(CC(c1ccccc1)c1ccc(NC(=O)OC(C)(C)C)nc1)C(=O)OCC |
| InChI | InChI=1S/C23H28N2O4/c1-6-28-21(26)16(2)14-19(17-10-8-7-9-11-17)18-12-13-20(24-15-18)25-22(27)29-23(3,4)5/h7-13,15,19H,2,6,14H2,1,3-5H3,(H,24,25,27) |
| InChIKey | JFQOYQDPUZCVNG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|