C31H33N3O5 — CID 70073818
2-[benzylcarbamoyl(3-methylbutyl)amino]-4-(1,3-dioxo-5-phenylisoindol-2-yl)butanoic acid (PubChem CID 70073818) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[benzylcarbamoyl(3-methylbutyl)amino]-4-(1,3-dioxo-5-phenylisoindol-2-yl)butanoic acid.
| Compound Name | 2-[benzylcarbamoyl(3-methylbutyl)amino]-4-(1,3-dioxo-5-phenylisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 70073818 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-[benzylcarbamoyl(3-methylbutyl)amino]-4-(1,3-dioxo-5-phenylisoindol-2-yl)butanoic acid |
| SMILES | CC(C)CCN(C(=O)NCc1ccccc1)C(CCN1C(=O)c2ccc(-c3ccccc3)cc2C1=O)C(=O)O |
| InChI | InChI=1S/C31H33N3O5/c1-21(2)15-17-33(31(39)32-20-22-9-5-3-6-10-22)27(30(37)38)16-18-34-28(35)25-14-13-24(19-26(25)29(34)36)23-11-7-4-8-12-23/h3-14,19,21,27H,15-18,20H2,1-2H3,(H,32,39)(H,37,38) |
| InChIKey | LJVBEAKEDIMKFX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|