C25H29N3O6 — CID 70086665
(2R)-2-[[(3S)-5-(benzylamino)-3-methyl-5-oxopentyl]amino]-4-(5-hydroxy-1,3-dioxoisoindol-2-yl)butanoic acid (PubChem CID 70086665) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is (2R)-2-[[(3S)-5-(benzylamino)-3-methyl-5-oxopentyl]amino]-4-(5-hydroxy-1,3-dioxoisoindol-2-yl)butanoic acid.
| Compound Name | (2R)-2-[[(3S)-5-(benzylamino)-3-methyl-5-oxopentyl]amino]-4-(5-hydroxy-1,3-dioxoisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 70086665 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (2R)-2-[[(3S)-5-(benzylamino)-3-methyl-5-oxopentyl]amino]-4-(5-hydroxy-1,3-dioxoisoindol-2-yl)butanoic acid |
| SMILES | C[C@@H](CCN[C@H](CCN1C(=O)c2ccc(O)cc2C1=O)C(=O)O)CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O6/c1-16(13-22(30)27-15-17-5-3-2-4-6-17)9-11-26-21(25(33)34)10-12-28-23(31)19-8-7-18(29)14-20(19)24(28)32/h2-8,14,16,21,26,29H,9-13,15H2,1H3,(H,27,30)(H,33,34)/t16-,21+/m0/s1 |
| InChIKey | POXUFWDKPVJRSI-HRAATJIYSA-N |
| XLogP | 2.15 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|