C20H22ClNO3S — CID 70076398
1-(1-benzothiophen-7-yl)-2-[2-(2-chloro-3,4-dimethoxyphenyl)ethylamino]ethanol (PubChem CID 70076398) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-2-[2-(2-chloro-3,4-dimethoxyphenyl)ethylamino]ethanol.
| Compound Name | 1-(1-benzothiophen-7-yl)-2-[2-(2-chloro-3,4-dimethoxyphenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 70076398 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-2-[2-(2-chloro-3,4-dimethoxyphenyl)ethylamino]ethanol |
| SMILES | COc1ccc(CCNCC(O)c2cccc3ccsc23)c(Cl)c1OC |
| InChI | InChI=1S/C20H22ClNO3S/c1-24-17-7-6-13(18(21)19(17)25-2)8-10-22-12-16(23)15-5-3-4-14-9-11-26-20(14)15/h3-7,9,11,16,22-23H,8,10,12H2,1-2H3 |
| InChIKey | OKLOGQDNUNTBIO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|