C26H28Cl2N4O3 — CID 70077336
2-[7-[[4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid;dihydrochloride (PubChem CID 70077336) has the molecular formula C26H28Cl2N4O3 and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-[7-[[4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid;dihydrochloride.
| Compound Name | 2-[7-[[4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 70077336 |
| Molecular Formula | C26H28Cl2N4O3 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[7-[[4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\Cc1ccccn1)c1ccc(C(=O)Nc2ccc3c(c2)CC(CC(=O)O)CC3)cc1 |
| InChI | InChI=1S/C26H26N4O3.2ClH/c27-25(29-16-23-3-1-2-12-28-23)19-6-8-20(9-7-19)26(33)30-22-11-10-18-5-4-17(14-24(31)32)13-21(18)15-22;;/h1-3,6-12,15,17H,4-5,13-14,16H2,(H2,27,29)(H,30,33)(H,31,32);2*1H |
| InChIKey | CQEKRCWUZPAULS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|