C13H12N2O5 — CID 70079768
2-[3-(2,3-dioxoindol-1-yl)propanoylamino]acetic acid (PubChem CID 70079768) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-[3-(2,3-dioxoindol-1-yl)propanoylamino]acetic acid.
| Compound Name | 2-[3-(2,3-dioxoindol-1-yl)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 70079768 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[3-(2,3-dioxoindol-1-yl)propanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H12N2O5/c16-10(14-7-11(17)18)5-6-15-9-4-2-1-3-8(9)12(19)13(15)20/h1-4H,5-7H2,(H,14,16)(H,17,18) |
| InChIKey | WWUQUGOIJNPQSQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|