C25H26N2O6S — CID 70086738
(2R)-4-benzylimino-2-[(4-methoxyphenyl)sulfonylamino]-4-phenylmethoxybutanoic acid (PubChem CID 70086738) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is (2R)-4-benzylimino-2-[(4-methoxyphenyl)sulfonylamino]-4-phenylmethoxybutanoic acid.
| Compound Name | (2R)-4-benzylimino-2-[(4-methoxyphenyl)sulfonylamino]-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 70086738 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (2R)-4-benzylimino-2-[(4-methoxyphenyl)sulfonylamino]-4-phenylmethoxybutanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C/C(=N/Cc2ccccc2)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-32-21-12-14-22(15-13-21)34(30,31)27-23(25(28)29)16-24(26-17-19-8-4-2-5-9-19)33-18-20-10-6-3-7-11-20/h2-15,23,27H,16-18H2,1H3,(H,28,29)/b26-24-/t23-/m1/s1 |
| InChIKey | CGYJFTHDAWLWOU-XGSHPVFQSA-N |
| XLogP | 3.63 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|