C20H20N2O2 — CID 70087262
3,7-dibenzyl-2H-1,3-diazepine-1-carboxylic acid (PubChem CID 70087262) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3,7-dibenzyl-2H-1,3-diazepine-1-carboxylic acid.
| Compound Name | 3,7-dibenzyl-2H-1,3-diazepine-1-carboxylic acid |
|---|---|
| PubChem CID | 70087262 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3,7-dibenzyl-2H-1,3-diazepine-1-carboxylic acid |
| SMILES | O=C(O)N1CN(Cc2ccccc2)C=CC=C1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c23-20(24)22-16-21(15-18-10-5-2-6-11-18)13-7-12-19(22)14-17-8-3-1-4-9-17/h1-13H,14-16H2,(H,23,24) |
| InChIKey | LCZJYEPJEXMQDB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |