C25H30O5S2 — CID 70091343
bis(6-butylsulfanyl-2,3-dihydro-1,4-benzodioxin-2-yl)methanone (PubChem CID 70091343) has the molecular formula C25H30O5S2 and a molecular weight of 474.64 g/mol. Its IUPAC name is bis(6-butylsulfanyl-2,3-dihydro-1,4-benzodioxin-2-yl)methanone.
| Compound Name | bis(6-butylsulfanyl-2,3-dihydro-1,4-benzodioxin-2-yl)methanone |
|---|---|
| PubChem CID | 70091343 |
| Molecular Formula | C25H30O5S2 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | bis(6-butylsulfanyl-2,3-dihydro-1,4-benzodioxin-2-yl)methanone |
| SMILES | CCCCSc1ccc2c(c1)OCC(C(=O)C1COc3cc(SCCCC)ccc3O1)O2 |
| InChI | InChI=1S/C25H30O5S2/c1-3-5-11-31-17-7-9-19-21(13-17)27-15-23(29-19)25(26)24-16-28-22-14-18(32-12-6-4-2)8-10-20(22)30-24/h7-10,13-14,23-24H,3-6,11-12,15-16H2,1-2H3 |
| InChIKey | HFHXUDWENBIORY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|