C20H28N6O3 — CID 70091948
ethyl 9-(2,6-diaminopyrimidin-4-yl)-3-(2-methylpyrimidin-5-yl)-5-oxononanoate (PubChem CID 70091948) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl 9-(2,6-diaminopyrimidin-4-yl)-3-(2-methylpyrimidin-5-yl)-5-oxononanoate.
| Compound Name | ethyl 9-(2,6-diaminopyrimidin-4-yl)-3-(2-methylpyrimidin-5-yl)-5-oxononanoate |
|---|---|
| PubChem CID | 70091948 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | ethyl 9-(2,6-diaminopyrimidin-4-yl)-3-(2-methylpyrimidin-5-yl)-5-oxononanoate |
| SMILES | CCOC(=O)CC(CC(=O)CCCCc1cc(N)nc(N)n1)c1cnc(C)nc1 |
| InChI | InChI=1S/C20H28N6O3/c1-3-29-19(28)9-14(15-11-23-13(2)24-12-15)8-17(27)7-5-4-6-16-10-18(21)26-20(22)25-16/h10-12,14H,3-9H2,1-2H3,(H4,21,22,25,26) |
| InChIKey | SIQBYPDDFGYNBJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|