C22H26FNO6S — CID 70092954
but-2-enedioic acid;3-(2-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)propan-1-amine (PubChem CID 70092954) has the molecular formula C22H26FNO6S and a molecular weight of 451.52 g/mol. Its IUPAC name is but-2-enedioic acid;3-(2-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)propan-1-amine.
| Compound Name | but-2-enedioic acid;3-(2-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 70092954 |
| Molecular Formula | C22H26FNO6S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | but-2-enedioic acid;3-(2-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)propan-1-amine |
| SMILES | CN(CCCS(=O)(=O)c1ccccc1F)CCc1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H22FNO2S.C4H4O4/c1-20(14-12-16-8-3-2-4-9-16)13-7-15-23(21,22)18-11-6-5-10-17(18)19;5-3(6)1-2-4(7)8/h2-6,8-11H,7,12-15H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HGUITJBAQYQPSY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|