C26H31NO4 — CID 70363611
(E)-but-2-enedioic acid;N-methyl-3-(7-methyl-1H-inden-2-yl)-N-(2-phenylethyl)propan-1-amine (PubChem CID 70363611) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-methyl-3-(7-methyl-1H-inden-2-yl)-N-(2-phenylethyl)propan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N-methyl-3-(7-methyl-1H-inden-2-yl)-N-(2-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 70363611 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (E)-but-2-enedioic acid;N-methyl-3-(7-methyl-1H-inden-2-yl)-N-(2-phenylethyl)propan-1-amine |
| SMILES | Cc1cccc2c1CC(CCCN(C)CCc1ccccc1)=C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H27N.C4H4O4/c1-18-8-6-12-21-16-20(17-22(18)21)11-7-14-23(2)15-13-19-9-4-3-5-10-19;5-3(6)1-2-4(7)8/h3-6,8-10,12,16H,7,11,13-15,17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QGHCGXUSJOKWTL-WLHGVMLRSA-N |
| XLogP | 4.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|