C26H31NO5 — CID 70363643
(E)-but-2-enedioic acid;7-methyl-2-[3-[methyl(2-phenylethyl)amino]propyl]-2,3-dihydroinden-1-one (PubChem CID 70363643) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;7-methyl-2-[3-[methyl(2-phenylethyl)amino]propyl]-2,3-dihydroinden-1-one.
| Compound Name | (E)-but-2-enedioic acid;7-methyl-2-[3-[methyl(2-phenylethyl)amino]propyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 70363643 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (E)-but-2-enedioic acid;7-methyl-2-[3-[methyl(2-phenylethyl)amino]propyl]-2,3-dihydroinden-1-one |
| SMILES | Cc1cccc2c1C(=O)C(CCCN(C)CCc1ccccc1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H27NO.C4H4O4/c1-17-8-6-11-19-16-20(22(24)21(17)19)12-7-14-23(2)15-13-18-9-4-3-5-10-18;5-3(6)1-2-4(7)8/h3-6,8-11,20H,7,12-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QSCJMTFCSIADLZ-WLHGVMLRSA-N |
| XLogP | 4.02 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|