C22H27NO4S — CID 70089949
but-2-enedioic acid;N-methyl-N-(2-phenylethyl)-3-phenylsulfanylpropan-1-amine (PubChem CID 70089949) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is but-2-enedioic acid;N-methyl-N-(2-phenylethyl)-3-phenylsulfanylpropan-1-amine.
| Compound Name | but-2-enedioic acid;N-methyl-N-(2-phenylethyl)-3-phenylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 70089949 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | but-2-enedioic acid;N-methyl-N-(2-phenylethyl)-3-phenylsulfanylpropan-1-amine |
| SMILES | CN(CCCSc1ccccc1)CCc1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H23NS.C4H4O4/c1-19(15-13-17-9-4-2-5-10-17)14-8-16-20-18-11-6-3-7-12-18;5-3(6)1-2-4(7)8/h2-7,9-12H,8,13-16H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GYKFOHJYASBNSB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|