C23H30N2O6S — CID 70094582
benzyl 4-(dimethylamino)-2-[(4-methoxyphenyl)sulfonylamino]-4-oxo-2-propan-2-ylbutanoate (PubChem CID 70094582) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is benzyl 4-(dimethylamino)-2-[(4-methoxyphenyl)sulfonylamino]-4-oxo-2-propan-2-ylbutanoate.
| Compound Name | benzyl 4-(dimethylamino)-2-[(4-methoxyphenyl)sulfonylamino]-4-oxo-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 70094582 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | benzyl 4-(dimethylamino)-2-[(4-methoxyphenyl)sulfonylamino]-4-oxo-2-propan-2-ylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)NC(CC(=O)N(C)C)(C(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O6S/c1-17(2)23(15-21(26)25(3)4,22(27)31-16-18-9-7-6-8-10-18)24-32(28,29)20-13-11-19(30-5)12-14-20/h6-14,17,24H,15-16H2,1-5H3 |
| InChIKey | LTARWPCKSJTDQG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |