C17H30N2O5 — CID 70096773
tert-butyl N-[1-[(3-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl)amino]-1-oxopentan-3-yl]carbamate (PubChem CID 70096773) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl)amino]-1-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl)amino]-1-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 70096773 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | tert-butyl N-[1-[(3-hydroxy-3,4,5,8-tetrahydro-2H-oxocin-4-yl)amino]-1-oxopentan-3-yl]carbamate |
| SMILES | CCC(CC(=O)NC1CC=CCOCC1O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N2O5/c1-5-12(18-16(22)24-17(2,3)4)10-15(21)19-13-8-6-7-9-23-11-14(13)20/h6-7,12-14,20H,5,8-11H2,1-4H3,(H,18,22)(H,19,21) |
| InChIKey | XJQZMMNGIAGCQJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|