C27H27N3O7S — CID 70097641
methyl 2-[[3-[methyl-[4-(morpholine-4-carbonyl)phenyl]sulfamoyl]benzoyl]amino]benzoate (PubChem CID 70097641) has the molecular formula C27H27N3O7S and a molecular weight of 537.59 g/mol. Its IUPAC name is methyl 2-[[3-[methyl-[4-(morpholine-4-carbonyl)phenyl]sulfamoyl]benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[3-[methyl-[4-(morpholine-4-carbonyl)phenyl]sulfamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 70097641 |
| Molecular Formula | C27H27N3O7S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | methyl 2-[[3-[methyl-[4-(morpholine-4-carbonyl)phenyl]sulfamoyl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccc(S(=O)(=O)N(C)c2ccc(C(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C27H27N3O7S/c1-29(21-12-10-19(11-13-21)26(32)30-14-16-37-17-15-30)38(34,35)22-7-5-6-20(18-22)25(31)28-24-9-4-3-8-23(24)27(33)36-2/h3-13,18H,14-17H2,1-2H3,(H,28,31) |
| InChIKey | FDPZKTHVNLUHPM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |